C29H25N5O2 — CID 156685485
(5aR,6R,9aS)-8-isocyano-6,9a-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-1-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one (PubChem CID 156685485) has the molecular formula C29H25N5O2 and a molecular weight of 475.55 g/mol. Its IUPAC name is (5aR,6R,9aS)-8-isocyano-6,9a-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-1-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one.
| Compound Name | (5aR,6R,9aS)-8-isocyano-6,9a-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-1-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one |
|---|---|
| PubChem CID | 156685485 |
| Molecular Formula | C29H25N5O2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | (5aR,6R,9aS)-8-isocyano-6,9a-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-1-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[g]indazol-7-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3c(c(-c4nc(C)no4)nn3-c3ccc(-c4ccccc4)cc3)CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C29H25N5O2/c1-17-23-15-14-22-25(28-31-18(2)33-36-28)32-34(27(22)29(23,3)16-24(30-4)26(17)35)21-12-10-20(11-13-21)19-8-6-5-7-9-19/h5-13,16-17,23H,14-15H2,1-3H3/t17-,23-,29-/m1/s1 |
| InChIKey | HTBBGGKTPVTZBL-QZZDXIJXSA-N |
| XLogP | 5.74 |
| TPSA | 78.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|