C31H34N4O3 — CID 176781534
tert-butyl 4-[(6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-8-oxo-4-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-2-yl]-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 176781534) has the molecular formula C31H34N4O3 and a molecular weight of 510.64 g/mol. Its IUPAC name is tert-butyl 4-[(6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-8-oxo-4-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-2-yl]-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-8-oxo-4-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-2-yl]-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 176781534 |
| Molecular Formula | C31H34N4O3 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | tert-butyl 4-[(6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-8-oxo-4-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-2-yl]-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(C4C=CN(C(=O)OC(C)(C)C)CC4)nc(-c4ccccc4)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C31H34N4O3/c1-19-23-13-12-22-25(20-10-8-7-9-11-20)33-28(34-27(22)31(23,5)18-24(32-6)26(19)36)21-14-16-35(17-15-21)29(37)38-30(2,3)4/h7-11,14,16,18-19,21,23H,12-13,15,17H2,1-5H3/t19-,21?,23-,31-/m1/s1 |
| InChIKey | AZSVAHAYEZSPQQ-KSVPQJPOSA-N |
| XLogP | 6.22 |
| TPSA | 76.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|