C28H22F3N3O — CID 153485517
(6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-4-phenyl-2-[4-(trifluoromethyl)phenyl]-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one (PubChem CID 153485517) has the molecular formula C28H22F3N3O and a molecular weight of 473.50 g/mol. Its IUPAC name is (6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-4-phenyl-2-[4-(trifluoromethyl)phenyl]-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-4-phenyl-2-[4-(trifluoromethyl)phenyl]-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 153485517 |
| Molecular Formula | C28H22F3N3O |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (6aR,7R,10aS)-9-isocyano-7,10a-dimethyl-4-phenyl-2-[4-(trifluoromethyl)phenyl]-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4ccc(C(F)(F)F)cc4)nc(-c4ccccc4)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C28H22F3N3O/c1-16-21-14-13-20-23(17-7-5-4-6-8-17)33-26(18-9-11-19(12-10-18)28(29,30)31)34-25(20)27(21,2)15-22(32-3)24(16)35/h4-12,15-16,21H,13-14H2,1-2H3/t16-,21-,27-/m1/s1 |
| InChIKey | LWGCVPOPHQQOPZ-YIPKYWMUSA-N |
| XLogP | 6.67 |
| TPSA | 47.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|