C26H20Cl2N4O — CID 153485661
(6aR,7R,10aS)-4-(3,4-dichlorophenyl)-9-isocyano-7,10a-dimethyl-2-pyridin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one (PubChem CID 153485661) has the molecular formula C26H20Cl2N4O and a molecular weight of 475.38 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-(3,4-dichlorophenyl)-9-isocyano-7,10a-dimethyl-2-pyridin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aS)-4-(3,4-dichlorophenyl)-9-isocyano-7,10a-dimethyl-2-pyridin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 153485661 |
| Molecular Formula | C26H20Cl2N4O |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | (6aR,7R,10aS)-4-(3,4-dichlorophenyl)-9-isocyano-7,10a-dimethyl-2-pyridin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4ccncc4)nc(-c4ccc(Cl)c(Cl)c4)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C26H20Cl2N4O/c1-14-18-6-5-17-22(16-4-7-19(27)20(28)12-16)31-25(15-8-10-30-11-9-15)32-24(17)26(18,2)13-21(29-3)23(14)33/h4,7-14,18H,5-6H2,1-2H3/t14-,18-,26-/m1/s1 |
| InChIKey | YFOMPGNTRJNFMI-LNMHWPHBSA-N |
| XLogP | 6.35 |
| TPSA | 60.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|