C32H27N3O — CID 153375659
(5aR,6R,9aS)-6,9a-dimethyl-7-oxo-3-phenyl-1-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 153375659) has the molecular formula C32H27N3O and a molecular weight of 469.59 g/mol. Its IUPAC name is (5aR,6R,9aS)-6,9a-dimethyl-7-oxo-3-phenyl-1-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-6,9a-dimethyl-7-oxo-3-phenyl-1-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 153375659 |
| Molecular Formula | C32H27N3O |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | (5aR,6R,9aS)-6,9a-dimethyl-7-oxo-3-phenyl-1-(4-phenylphenyl)-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3c(c(-c4ccccc4)nn3-c3ccc(-c4ccccc4)cc3)CC[C@H]12 |
| InChI | InChI=1S/C32H27N3O/c1-21-28-18-17-27-29(24-11-7-4-8-12-24)34-35(31(27)32(28,2)19-25(20-33)30(21)36)26-15-13-23(14-16-26)22-9-5-3-6-10-22/h3-16,19,21,28H,17-18H2,1-2H3/t21-,28-,32-/m1/s1 |
| InChIKey | XDSXEHFNNXQWOU-NTYRGRDKSA-N |
| XLogP | 6.70 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |