C31H26FN5O — CID 153379873
(5aR,6R,9aS)-1-[4-[2-(fluoromethyl)-4-pyridinyl]phenyl]-6,9a-dimethyl-7-oxo-3-pyridin-3-yl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 153379873) has the molecular formula C31H26FN5O and a molecular weight of 503.58 g/mol. Its IUPAC name is (5aR,6R,9aS)-1-[4-[2-(fluoromethyl)-4-pyridinyl]phenyl]-6,9a-dimethyl-7-oxo-3-pyridin-3-yl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-1-[4-[2-(fluoromethyl)-4-pyridinyl]phenyl]-6,9a-dimethyl-7-oxo-3-pyridin-3-yl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 153379873 |
| Molecular Formula | C31H26FN5O |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | (5aR,6R,9aS)-1-[4-[2-(fluoromethyl)-4-pyridinyl]phenyl]-6,9a-dimethyl-7-oxo-3-pyridin-3-yl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3c(c(-c4cccnc4)nn3-c3ccc(-c4ccnc(CF)c4)cc3)CC[C@H]12 |
| InChI | InChI=1S/C31H26FN5O/c1-19-27-10-9-26-28(22-4-3-12-34-18-22)36-37(30(26)31(27,2)15-23(17-33)29(19)38)25-7-5-20(6-8-25)21-11-13-35-24(14-21)16-32/h3-8,11-15,18-19,27H,9-10,16H2,1-2H3/t19-,27-,31-/m1/s1 |
| InChIKey | CYCLPJBLQHGHNY-PSODQSIBSA-N |
| XLogP | 5.95 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |