C34H33N5O — CID 157081162
(5aR,6R,9aS)-9a-methyl-3-(4-methylphenyl)-1-[4-(6-methylpyridazin-4-yl)phenyl]-7-oxo-6-propyl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 157081162) has the molecular formula C34H33N5O and a molecular weight of 527.67 g/mol. Its IUPAC name is (5aR,6R,9aS)-9a-methyl-3-(4-methylphenyl)-1-[4-(6-methylpyridazin-4-yl)phenyl]-7-oxo-6-propyl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-9a-methyl-3-(4-methylphenyl)-1-[4-(6-methylpyridazin-4-yl)phenyl]-7-oxo-6-propyl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 157081162 |
| Molecular Formula | C34H33N5O |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | (5aR,6R,9aS)-9a-methyl-3-(4-methylphenyl)-1-[4-(6-methylpyridazin-4-yl)phenyl]-7-oxo-6-propyl-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | CCC[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3c(c(-c4ccc(C)cc4)nn3-c3ccc(-c4cnnc(C)c4)cc3)CC[C@H]12 |
| InChI | InChI=1S/C34H33N5O/c1-5-6-28-30-16-15-29-31(24-9-7-21(2)8-10-24)38-39(33(29)34(30,4)18-26(19-35)32(28)40)27-13-11-23(12-14-27)25-17-22(3)37-36-20-25/h7-14,17-18,20,28,30H,5-6,15-16H2,1-4H3/t28-,30-,34-/m1/s1 |
| InChIKey | ZKLMBUYJOAFLRJ-QWMOYVMOSA-N |
| XLogP | 6.88 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |