C20H25NO4 — CID 146248650
(4aS,5S,7Z,8aS)-7-(hydroxymethylidene)-2-(2-methoxyethyl)-5-methyl-8a-phenyl-4,4a,5,8-tetrahydro-3H-isoquinoline-1,6-dione (PubChem CID 146248650) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (4aS,5S,7Z,8aS)-7-(hydroxymethylidene)-2-(2-methoxyethyl)-5-methyl-8a-phenyl-4,4a,5,8-tetrahydro-3H-isoquinoline-1,6-dione.
| Compound Name | (4aS,5S,7Z,8aS)-7-(hydroxymethylidene)-2-(2-methoxyethyl)-5-methyl-8a-phenyl-4,4a,5,8-tetrahydro-3H-isoquinoline-1,6-dione |
|---|---|
| PubChem CID | 146248650 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (4aS,5S,7Z,8aS)-7-(hydroxymethylidene)-2-(2-methoxyethyl)-5-methyl-8a-phenyl-4,4a,5,8-tetrahydro-3H-isoquinoline-1,6-dione |
| SMILES | COCCN1CC[C@H]2[C@H](C)C(=O)/C(=C\O)C[C@]2(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H25NO4/c1-14-17-8-9-21(10-11-25-2)19(24)20(17,12-15(13-22)18(14)23)16-6-4-3-5-7-16/h3-7,13-14,17,22H,8-12H2,1-2H3/b15-13-/t14-,17-,20+/m0/s1 |
| InChIKey | YVOPGODASZGEJX-FZCHKUPDSA-N |
| XLogP | 2.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|