C18H25NO4 — CID 142337344
acetylene;ethylbenzene;(3S)-1-(2-methoxyethyl)-2-oxopyrrolidine-3-carboxylic acid (PubChem CID 142337344) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is acetylene;ethylbenzene;(3S)-1-(2-methoxyethyl)-2-oxopyrrolidine-3-carboxylic acid.
| Compound Name | acetylene;ethylbenzene;(3S)-1-(2-methoxyethyl)-2-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 142337344 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | acetylene;ethylbenzene;(3S)-1-(2-methoxyethyl)-2-oxopyrrolidine-3-carboxylic acid |
| SMILES | C#C.CCc1ccccc1.COCCN1CC[C@H](C(=O)O)C1=O |
| InChI | InChI=1S/C8H13NO4.C8H10.C2H2/c1-13-5-4-9-3-2-6(7(9)10)8(11)12;1-2-8-6-4-3-5-7-8;1-2/h6H,2-5H2,1H3,(H,11,12);3-7H,2H2,1H3;1-2H/t6-;;/m0../s1 |
| InChIKey | LHZBAVVYOPTERY-ILKKLZGPSA-N |
| XLogP | 2.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|