C16H19NO5 — CID 138523437
2-[(3R,4R)-4-benzyl-1-(2-methoxyethyl)-5-oxopyrrolidin-3-yl]-2-oxoacetic acid (PubChem CID 138523437) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-[(3R,4R)-4-benzyl-1-(2-methoxyethyl)-5-oxopyrrolidin-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[(3R,4R)-4-benzyl-1-(2-methoxyethyl)-5-oxopyrrolidin-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 138523437 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-[(3R,4R)-4-benzyl-1-(2-methoxyethyl)-5-oxopyrrolidin-3-yl]-2-oxoacetic acid |
| SMILES | COCCN1C[C@H](C(=O)C(=O)O)[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C16H19NO5/c1-22-8-7-17-10-13(14(18)16(20)21)12(15(17)19)9-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3,(H,20,21)/t12-,13+/m1/s1 |
| InChIKey | UBUCRHNWDRABHS-OLZOCXBDSA-N |
| XLogP | 0.60 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|