(3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid

C13H13NO5 — CID 138523447

IUPAC(3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid
SMILESO=C(O)[C@H]1CN(C(=O)O)C(=O)[C@@H]1Cc1ccccc1
InChIInChI=1S/C13H13NO5/c15-11-9(6-8-4-2-1-3-5-8)10(12(16)17)7-14(11)13(18)19/h1-5,9-10H,6-7H2,(H,16,17)(H,18,19)/t9-,10+/m1/s1
InChIKeyHTNMROHTXDLJQD-ZJUUUORDSA-N
MW263.25 g/mol
LogP1.07
Rot. Bonds3

About (3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid

(3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid (PubChem CID 138523447) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is (3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid.

Molecular Properties

Compound Name(3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid
PubChem CID138523447
Molecular FormulaC13H13NO5
Molecular Weight263.25 g/mol
Exact Mass263.08
IUPAC Name(3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid
SMILESO=C(O)[C@H]1CN(C(=O)O)C(=O)[C@@H]1Cc1ccccc1
InChIInChI=1S/C13H13NO5/c15-11-9(6-8-4-2-1-3-5-8)10(12(16)17)7-14(11)13(18)19/h1-5,9-10H,6-7H2,(H,16,17)(H,18,19)/t9-,10+/m1/s1
InChIKeyHTNMROHTXDLJQD-ZJUUUORDSA-N
XLogP1.07
TPSA94.91 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.25
LogP ≤ 51.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid?
The IUPAC name of (3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid (CID 138523447) is (3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid.
What is the SMILES notation for (3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid?
The canonical SMILES for (3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid is O=C(O)[C@H]1CN(C(=O)O)C(=O)[C@@H]1Cc1ccccc1.
What is the InChIKey of (3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid?
The InChIKey is HTNMROHTXDLJQD-ZJUUUORDSA-N. The full InChI is InChI=1S/C13H13NO5/c15-11-9(6-8-4-2-1-3-5-8)10(12(16)17)7-14(11)13(18)19/h1-5,9-10H,6-7H2,(H,16,17)(H,18,19)/t9-,10+/m1/s1.
What are the key properties of (3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid?
(3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid has a molecular weight of 263.25 g/mol, XLogP of 1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-benzyl-5-oxopyrrolidine-1,3-dicarboxylic acid is sourced from PubChem (CID 138523447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).