C17H18N2O2 — CID 135194728
(4aS,5S)-5-methyl-1,6-dioxo-8a-phenyl-3,4,4a,5,7,8-hexahydro-2H-isoquinoline-7-carbonitrile (PubChem CID 135194728) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (4aS,5S)-5-methyl-1,6-dioxo-8a-phenyl-3,4,4a,5,7,8-hexahydro-2H-isoquinoline-7-carbonitrile.
| Compound Name | (4aS,5S)-5-methyl-1,6-dioxo-8a-phenyl-3,4,4a,5,7,8-hexahydro-2H-isoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 135194728 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (4aS,5S)-5-methyl-1,6-dioxo-8a-phenyl-3,4,4a,5,7,8-hexahydro-2H-isoquinoline-7-carbonitrile |
| SMILES | C[C@@H]1C(=O)C(C#N)CC2(c3ccccc3)C(=O)NCC[C@@H]12 |
| InChI | InChI=1S/C17H18N2O2/c1-11-14-7-8-19-16(21)17(14,9-12(10-18)15(11)20)13-5-3-2-4-6-13/h2-6,11-12,14H,7-9H2,1H3,(H,19,21)/t11-,12?,14-,17?/m0/s1 |
| InChIKey | PTYQEXCPNNHUSM-NYYRHTKUSA-N |
| XLogP | 1.81 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|