C26H24N4O2 — CID 175193571
(6aS,7S,10aR)-2,7-dimethyl-8-oxo-4-(6-oxo-1H-pyridin-3-yl)-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 175193571) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is (6aS,7S,10aR)-2,7-dimethyl-8-oxo-4-(6-oxo-1H-pyridin-3-yl)-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aS,7S,10aR)-2,7-dimethyl-8-oxo-4-(6-oxo-1H-pyridin-3-yl)-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 175193571 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (6aS,7S,10aR)-2,7-dimethyl-8-oxo-4-(6-oxo-1H-pyridin-3-yl)-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | Cc1nc(-c2ccc(=O)[nH]c2)c2c(n1)[C@]1(c3ccccc3)CC(C#N)C(=O)[C@@H](C)[C@@H]1CC2 |
| InChI | InChI=1S/C26H24N4O2/c1-15-21-10-9-20-23(17-8-11-22(31)28-14-17)29-16(2)30-25(20)26(21,12-18(13-27)24(15)32)19-6-4-3-5-7-19/h3-8,11,14-15,18,21H,9-10,12H2,1-2H3,(H,28,31)/t15-,18?,21-,26-/m0/s1 |
| InChIKey | HBPFABUZHJSPGH-VKPLQMNASA-N |
| XLogP | 3.74 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|