C25H26N4O2 — CID 118291349
(6aS,7S,9Z,10aS)-9-(hydroxymethylidene)-2,7-dimethyl-4-(1-methylpyrazol-4-yl)-10a-phenyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one (PubChem CID 118291349) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is (6aS,7S,9Z,10aS)-9-(hydroxymethylidene)-2,7-dimethyl-4-(1-methylpyrazol-4-yl)-10a-phenyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one.
| Compound Name | (6aS,7S,9Z,10aS)-9-(hydroxymethylidene)-2,7-dimethyl-4-(1-methylpyrazol-4-yl)-10a-phenyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 118291349 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (6aS,7S,9Z,10aS)-9-(hydroxymethylidene)-2,7-dimethyl-4-(1-methylpyrazol-4-yl)-10a-phenyl-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one |
| SMILES | Cc1nc(-c2cnn(C)c2)c2c(n1)[C@@]1(c3ccccc3)C/C(=C/O)C(=O)[C@@H](C)[C@@H]1CC2 |
| InChI | InChI=1S/C25H26N4O2/c1-15-21-10-9-20-22(18-12-26-29(3)13-18)27-16(2)28-24(20)25(21,11-17(14-30)23(15)31)19-7-5-4-6-8-19/h4-8,12-15,21,30H,9-11H2,1-3H3/b17-14-/t15-,21-,25+/m0/s1 |
| InChIKey | JYXXWZMJNQNRCN-BCBNGWCHSA-N |
| XLogP | 4.08 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|