C19H20N2O2 — CID 118291841
(5aS,6S,8Z,9aS)-8-(hydroxymethylidene)-6-methyl-9a-phenyl-1,4,5,5a,6,9-hexahydrobenzo[g]indazol-7-one (PubChem CID 118291841) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (5aS,6S,8Z,9aS)-8-(hydroxymethylidene)-6-methyl-9a-phenyl-1,4,5,5a,6,9-hexahydrobenzo[g]indazol-7-one.
| Compound Name | (5aS,6S,8Z,9aS)-8-(hydroxymethylidene)-6-methyl-9a-phenyl-1,4,5,5a,6,9-hexahydrobenzo[g]indazol-7-one |
|---|---|
| PubChem CID | 118291841 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (5aS,6S,8Z,9aS)-8-(hydroxymethylidene)-6-methyl-9a-phenyl-1,4,5,5a,6,9-hexahydrobenzo[g]indazol-7-one |
| SMILES | C[C@@H]1C(=O)/C(=C\O)C[C@]2(c3ccccc3)c3[nH]ncc3CC[C@@H]12 |
| InChI | InChI=1S/C19H20N2O2/c1-12-16-8-7-13-10-20-21-18(13)19(16,9-14(11-22)17(12)23)15-5-3-2-4-6-15/h2-6,10-12,16,22H,7-9H2,1H3,(H,20,21)/b14-11-/t12-,16-,19+/m0/s1 |
| InChIKey | CXYCRDIQOUUICZ-JHZUWFJWSA-N |
| XLogP | 3.31 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|