C26H26N2O2 — CID 118291071
(5aS,6S,8Z,9aS)-8-(hydroxymethylidene)-1,6-dimethyl-3,9a-diphenyl-5,5a,6,9-tetrahydro-4H-benzo[g]indazol-7-one (PubChem CID 118291071) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is (5aS,6S,8Z,9aS)-8-(hydroxymethylidene)-1,6-dimethyl-3,9a-diphenyl-5,5a,6,9-tetrahydro-4H-benzo[g]indazol-7-one.
| Compound Name | (5aS,6S,8Z,9aS)-8-(hydroxymethylidene)-1,6-dimethyl-3,9a-diphenyl-5,5a,6,9-tetrahydro-4H-benzo[g]indazol-7-one |
|---|---|
| PubChem CID | 118291071 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (5aS,6S,8Z,9aS)-8-(hydroxymethylidene)-1,6-dimethyl-3,9a-diphenyl-5,5a,6,9-tetrahydro-4H-benzo[g]indazol-7-one |
| SMILES | C[C@@H]1C(=O)/C(=C\O)C[C@]2(c3ccccc3)c3c(c(-c4ccccc4)nn3C)CC[C@@H]12 |
| InChI | InChI=1S/C26H26N2O2/c1-17-22-14-13-21-23(18-9-5-3-6-10-18)27-28(2)25(21)26(22,15-19(16-29)24(17)30)20-11-7-4-8-12-20/h3-12,16-17,22,29H,13-15H2,1-2H3/b19-16-/t17-,22-,26+/m0/s1 |
| InChIKey | IVDBGNSYNINXFT-OHASDLNISA-N |
| XLogP | 4.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|