C31H30N4O3 — CID 154369847
(6aS,7S,10aS)-9-(hydroxymethylidene)-10a-(4-methoxyphenyl)-2,7-dimethyl-4-[4-(1H-pyrazol-5-yl)phenyl]-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one (PubChem CID 154369847) has the molecular formula C31H30N4O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is (6aS,7S,10aS)-9-(hydroxymethylidene)-10a-(4-methoxyphenyl)-2,7-dimethyl-4-[4-(1H-pyrazol-5-yl)phenyl]-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one.
| Compound Name | (6aS,7S,10aS)-9-(hydroxymethylidene)-10a-(4-methoxyphenyl)-2,7-dimethyl-4-[4-(1H-pyrazol-5-yl)phenyl]-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 154369847 |
| Molecular Formula | C31H30N4O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (6aS,7S,10aS)-9-(hydroxymethylidene)-10a-(4-methoxyphenyl)-2,7-dimethyl-4-[4-(1H-pyrazol-5-yl)phenyl]-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-one |
| SMILES | COc1ccc([C@]23CC(=CO)C(=O)[C@@H](C)[C@@H]2CCc2c(-c4ccc(-c5ccn[nH]5)cc4)nc(C)nc23)cc1 |
| InChI | InChI=1S/C31H30N4O3/c1-18-26-13-12-25-28(21-6-4-20(5-7-21)27-14-15-32-35-27)33-19(2)34-30(25)31(26,16-22(17-36)29(18)37)23-8-10-24(38-3)11-9-23/h4-11,14-15,17-18,26,36H,12-13,16H2,1-3H3,(H,32,35)/t18-,26-,31+/m0/s1 |
| InChIKey | JLYCFEFWXGEDHX-LVAJYGNLSA-N |
| XLogP | 5.75 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|