C27H26N4O — CID 167052672
(6aR,7R,10aR)-7,10a-dimethyl-2-(2-methyl-4-pyridinyl)-8-oxo-4-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 167052672) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is (6aR,7R,10aR)-7,10a-dimethyl-2-(2-methyl-4-pyridinyl)-8-oxo-4-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aR)-7,10a-dimethyl-2-(2-methyl-4-pyridinyl)-8-oxo-4-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 167052672 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (6aR,7R,10aR)-7,10a-dimethyl-2-(2-methyl-4-pyridinyl)-8-oxo-4-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | Cc1cc(-c2nc(-c3ccccc3)c3c(n2)[C@]2(C)CC(C#N)C(=O)[C@H](C)[C@H]2CC3)ccn1 |
| InChI | InChI=1S/C27H26N4O/c1-16-13-19(11-12-29-16)26-30-23(18-7-5-4-6-8-18)21-9-10-22-17(2)24(32)20(15-28)14-27(22,3)25(21)31-26/h4-8,11-13,17,20,22H,9-10,14H2,1-3H3/t17-,20?,22-,27-/m1/s1 |
| InChIKey | DDLWNZMIEAVFJX-ZJWLKGNXSA-N |
| XLogP | 5.08 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|