C20H21N3O2 — CID 175183740
(5aS,6S,9aR)-9a-(4-methoxyphenyl)-6-methyl-7-oxo-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole-8-carbonitrile (PubChem CID 175183740) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is (5aS,6S,9aR)-9a-(4-methoxyphenyl)-6-methyl-7-oxo-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole-8-carbonitrile.
| Compound Name | (5aS,6S,9aR)-9a-(4-methoxyphenyl)-6-methyl-7-oxo-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 175183740 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (5aS,6S,9aR)-9a-(4-methoxyphenyl)-6-methyl-7-oxo-4,5,5a,6,8,9-hexahydro-1H-benzo[g]indazole-8-carbonitrile |
| SMILES | COc1ccc([C@@]23CC(C#N)C(=O)[C@@H](C)[C@@H]2CCc2cn[nH]c23)cc1 |
| InChI | InChI=1S/C20H21N3O2/c1-12-17-8-3-13-11-22-23-19(13)20(17,9-14(10-21)18(12)24)15-4-6-16(25-2)7-5-15/h4-7,11-12,14,17H,3,8-9H2,1-2H3,(H,22,23)/t12-,14?,17-,20-/m0/s1 |
| InChIKey | BYFPLCYAHGXLFJ-VGXJXSSLSA-N |
| XLogP | 3.02 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|