C20H14F6O4 — CID 10320569
methyl 3-[(1R,4R)-1,2,2,3,3,4-hexafluoro-4-(3-methoxycarbonylphenyl)cyclobutyl]benzoate (PubChem CID 10320569) has the molecular formula C20H14F6O4 and a molecular weight of 432.32 g/mol. Its IUPAC name is methyl 3-[(1R,4R)-1,2,2,3,3,4-hexafluoro-4-(3-methoxycarbonylphenyl)cyclobutyl]benzoate.
| Compound Name | methyl 3-[(1R,4R)-1,2,2,3,3,4-hexafluoro-4-(3-methoxycarbonylphenyl)cyclobutyl]benzoate |
|---|---|
| PubChem CID | 10320569 |
| Molecular Formula | C20H14F6O4 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | methyl 3-[(1R,4R)-1,2,2,3,3,4-hexafluoro-4-(3-methoxycarbonylphenyl)cyclobutyl]benzoate |
| SMILES | COC(=O)c1cccc([C@]2(F)C(F)(F)C(F)(F)[C@@]2(F)c2cccc(C(=O)OC)c2)c1 |
| InChI | InChI=1S/C20H14F6O4/c1-29-15(27)11-5-3-7-13(9-11)17(21)18(22,20(25,26)19(17,23)24)14-8-4-6-12(10-14)16(28)30-2/h3-10H,1-2H3/t17-,18-/m1/s1 |
| InChIKey | JTTQRNFBKCICEW-QZTJIDSGSA-N |
| XLogP | 4.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|