C25H22F2N2O — CID 118291755
(6aS,7S,10aS)-2-(2,6-difluorophenyl)-7-methyl-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one (PubChem CID 118291755) has the molecular formula C25H22F2N2O and a molecular weight of 404.46 g/mol. Its IUPAC name is (6aS,7S,10aS)-2-(2,6-difluorophenyl)-7-methyl-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aS,7S,10aS)-2-(2,6-difluorophenyl)-7-methyl-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 118291755 |
| Molecular Formula | C25H22F2N2O |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (6aS,7S,10aS)-2-(2,6-difluorophenyl)-7-methyl-10a-phenyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
| SMILES | C[C@@H]1C(=O)CC[C@]2(c3ccccc3)c3nc(-c4c(F)cccc4F)ncc3CC[C@@H]12 |
| InChI | InChI=1S/C25H22F2N2O/c1-15-18-11-10-16-14-28-24(22-19(26)8-5-9-20(22)27)29-23(16)25(18,13-12-21(15)30)17-6-3-2-4-7-17/h2-9,14-15,18H,10-13H2,1H3/t15-,18-,25+/m0/s1 |
| InChIKey | DCUSDUILAZFPNV-NNSISHGFSA-N |
| XLogP | 5.27 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |