C26H26FN3O2 — CID 118291428
(6'aS,7'S,10'aS)-10'a-(4-fluorophenyl)-7'-methyl-2'-pyridin-3-ylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] (PubChem CID 118291428) has the molecular formula C26H26FN3O2 and a molecular weight of 431.51 g/mol. Its IUPAC name is (6'aS,7'S,10'aS)-10'a-(4-fluorophenyl)-7'-methyl-2'-pyridin-3-ylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline].
| Compound Name | (6'aS,7'S,10'aS)-10'a-(4-fluorophenyl)-7'-methyl-2'-pyridin-3-ylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] |
|---|---|
| PubChem CID | 118291428 |
| Molecular Formula | C26H26FN3O2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (6'aS,7'S,10'aS)-10'a-(4-fluorophenyl)-7'-methyl-2'-pyridin-3-ylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline] |
| SMILES | C[C@H]1[C@@H]2CCc3cnc(-c4cccnc4)nc3[C@@]2(c2ccc(F)cc2)CCC12OCCO2 |
| InChI | InChI=1S/C26H26FN3O2/c1-17-22-9-4-18-16-29-24(19-3-2-12-28-15-19)30-23(18)25(22,20-5-7-21(27)8-6-20)10-11-26(17)31-13-14-32-26/h2-3,5-8,12,15-17,22H,4,9-11,13-14H2,1H3/t17-,22-,25+/m0/s1 |
| InChIKey | KFXGCRXWSPCMCL-QOKIKDITSA-N |
| XLogP | 4.70 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |