C27H28N2O3 — CID 137010120
7'-methyl-2',10'a-diphenylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydro-3H-benzo[h]quinazoline]-4'-one (PubChem CID 137010120) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 7'-methyl-2',10'a-diphenylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydro-3H-benzo[h]quinazoline]-4'-one.
| Compound Name | 7'-methyl-2',10'a-diphenylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydro-3H-benzo[h]quinazoline]-4'-one |
|---|---|
| PubChem CID | 137010120 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 7'-methyl-2',10'a-diphenylspiro[1,3-dioxolane-2,8'-5,6,6a,7,9,10-hexahydro-3H-benzo[h]quinazoline]-4'-one |
| SMILES | CC1C2CCc3c(nc(-c4ccccc4)[nH]c3=O)C2(c2ccccc2)CCC12OCCO2 |
| InChI | InChI=1S/C27H28N2O3/c1-18-22-13-12-21-23(28-24(29-25(21)30)19-8-4-2-5-9-19)26(22,20-10-6-3-7-11-20)14-15-27(18)31-16-17-32-27/h2-11,18,22H,12-17H2,1H3,(H,28,29,30) |
| InChIKey | AAAVIIWZQDECJW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |