C27H30O5 — CID 118291622
(2'Z,4'aS,5'S,8'aS)-2'-(hydroxymethylidene)-5'-methyl-8'a-(4-phenylmethoxyphenyl)spiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydronaphthalene]-1'-one (PubChem CID 118291622) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is (2'Z,4'aS,5'S,8'aS)-2'-(hydroxymethylidene)-5'-methyl-8'a-(4-phenylmethoxyphenyl)spiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydronaphthalene]-1'-one.
| Compound Name | (2'Z,4'aS,5'S,8'aS)-2'-(hydroxymethylidene)-5'-methyl-8'a-(4-phenylmethoxyphenyl)spiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 118291622 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (2'Z,4'aS,5'S,8'aS)-2'-(hydroxymethylidene)-5'-methyl-8'a-(4-phenylmethoxyphenyl)spiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydronaphthalene]-1'-one |
| SMILES | C[C@H]1[C@@H]2CC/C(=C/O)C(=O)[C@@]2(c2ccc(OCc3ccccc3)cc2)CCC12OCCO2 |
| InChI | InChI=1S/C27H30O5/c1-19-24-12-7-21(17-28)25(29)26(24,13-14-27(19)31-15-16-32-27)22-8-10-23(11-9-22)30-18-20-5-3-2-4-6-20/h2-6,8-11,17,19,24,28H,7,12-16,18H2,1H3/b21-17-/t19-,24-,26+/m0/s1 |
| InChIKey | OBLBWLJMSDFGPH-NFSQHGIQSA-N |
| XLogP | 5.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|