C33H34O3 — CID 57045906
(8R,9S,10R,13S,14S)-10,13-dimethyl-16-[(4-phenylmethoxyphenyl)methylidene]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57045906) has the molecular formula C33H34O3 and a molecular weight of 478.63 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-16-[(4-phenylmethoxyphenyl)methylidene]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-16-[(4-phenylmethoxyphenyl)methylidene]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57045906 |
| Molecular Formula | C33H34O3 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-16-[(4-phenylmethoxyphenyl)methylidene]-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)C(=Cc3ccc(OCc4ccccc4)cc3)C[C@@H]12 |
| InChI | InChI=1S/C33H34O3/c1-32-16-14-26(34)20-25(32)10-13-28-29(32)15-17-33(2)30(28)19-24(31(33)35)18-22-8-11-27(12-9-22)36-21-23-6-4-3-5-7-23/h3-9,11-12,14,16,18,20,28-30H,10,13,15,17,19,21H2,1-2H3/t28-,29+,30+,32+,33+/m1/s1 |
| InChIKey | PDZYRMKBFQXOTO-STOHTMMWSA-N |
| XLogP | 7.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|