C28H32O3 — CID 57206987
(8R,9S,10R,13S,14S)-16-[(4-ethoxyphenyl)methylidene]-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57206987) has the molecular formula C28H32O3 and a molecular weight of 416.56 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-16-[(4-ethoxyphenyl)methylidene]-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-16-[(4-ethoxyphenyl)methylidene]-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57206987 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (8R,9S,10R,13S,14S)-16-[(4-ethoxyphenyl)methylidene]-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CCOc1ccc(C=C2C[C@H]3[C@@H]4CCC5=CC(=O)C=C[C@]5(C)[C@H]4CC[C@]3(C)C2=O)cc1 |
| InChI | InChI=1S/C28H32O3/c1-4-31-22-8-5-18(6-9-22)15-19-16-25-23-10-7-20-17-21(29)11-13-27(20,2)24(23)12-14-28(25,3)26(19)30/h5-6,8-9,11,13,15,17,23-25H,4,7,10,12,14,16H2,1-3H3/t23-,24+,25+,27+,28+/m1/s1 |
| InChIKey | JSJOBANRLAIUMD-MJBIDBNXSA-N |
| XLogP | 5.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|