C27H30O3 — CID 57317572
(8R,9S,10R,13S,14S)-16-[(4-methoxyphenyl)methylidene]-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57317572) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-16-[(4-methoxyphenyl)methylidene]-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-16-[(4-methoxyphenyl)methylidene]-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57317572 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (8R,9S,10R,13S,14S)-16-[(4-methoxyphenyl)methylidene]-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | COc1ccc(C=C2C[C@H]3[C@@H]4CCC5=CC(=O)C=C[C@]5(C)[C@H]4CC[C@]3(C)C2=O)cc1 |
| InChI | InChI=1S/C27H30O3/c1-26-12-10-20(28)16-19(26)6-9-22-23(26)11-13-27(2)24(22)15-18(25(27)29)14-17-4-7-21(30-3)8-5-17/h4-5,7-8,10,12,14,16,22-24H,6,9,11,13,15H2,1-3H3/t22-,23+,24+,26+,27+/m1/s1 |
| InChIKey | LHZKZUGWTGTNFF-XEGHRTBSSA-N |
| XLogP | 5.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|