C34H40O5S — CID 143830162
8-(2-hydroxysulfanylethyl)-4a,7-dimethyl-7-[2-oxo-3-(4-phenylmethoxyphenoxy)propyl]-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-one (PubChem CID 143830162) has the molecular formula C34H40O5S and a molecular weight of 560.76 g/mol. Its IUPAC name is 8-(2-hydroxysulfanylethyl)-4a,7-dimethyl-7-[2-oxo-3-(4-phenylmethoxyphenoxy)propyl]-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-one.
| Compound Name | 8-(2-hydroxysulfanylethyl)-4a,7-dimethyl-7-[2-oxo-3-(4-phenylmethoxyphenoxy)propyl]-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-one |
|---|---|
| PubChem CID | 143830162 |
| Molecular Formula | C34H40O5S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 8-(2-hydroxysulfanylethyl)-4a,7-dimethyl-7-[2-oxo-3-(4-phenylmethoxyphenoxy)propyl]-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-one |
| SMILES | CC1(CC(=O)COc2ccc(OCc3ccccc3)cc2)CCC2C(CCC3=CC(=O)C=CC32C)C1CCSO |
| InChI | InChI=1S/C34H40O5S/c1-33(21-27(36)23-39-29-11-9-28(10-12-29)38-22-24-6-4-3-5-7-24)17-15-32-30(31(33)16-19-40-37)13-8-25-20-26(35)14-18-34(25,32)2/h3-7,9-12,14,18,20,30-32,37H,8,13,15-17,19,21-23H2,1-2H3 |
| InChIKey | ISHMIRVAGFKFMJ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|