C27H32O2S — CID 56618544
(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(2-phenylethylsulfanyl)-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,11-dione (PubChem CID 56618544) has the molecular formula C27H32O2S and a molecular weight of 420.62 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(2-phenylethylsulfanyl)-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(2-phenylethylsulfanyl)-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 56618544 |
| Molecular Formula | C27H32O2S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-10,13-dimethyl-17-(2-phenylethylsulfanyl)-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,11-dione |
| SMILES | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)C=C[C@@]43C)[C@@H]1CC[C@H]2SCCc1ccccc1 |
| InChI | InChI=1S/C27H32O2S/c1-26-14-12-20(28)16-19(26)8-9-21-22-10-11-24(27(22,2)17-23(29)25(21)26)30-15-13-18-6-4-3-5-7-18/h3-7,12,14,16,21-22,24-25H,8-11,13,15,17H2,1-2H3/t21-,22-,24+,25+,26-,27-/m0/s1 |
| InChIKey | IFVPIDGDWGJNFB-XISQYIGNSA-N |
| XLogP | 5.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |