C21H25NO6 — CID 18594003
[(8S,9S,10R,13R,14S,17S)-17-acetyl-10-methyl-3,11-dioxo-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-13-yl]methyl nitrate (PubChem CID 18594003) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is [(8S,9S,10R,13R,14S,17S)-17-acetyl-10-methyl-3,11-dioxo-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-13-yl]methyl nitrate.
| Compound Name | [(8S,9S,10R,13R,14S,17S)-17-acetyl-10-methyl-3,11-dioxo-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-13-yl]methyl nitrate |
|---|---|
| PubChem CID | 18594003 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | [(8S,9S,10R,13R,14S,17S)-17-acetyl-10-methyl-3,11-dioxo-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-13-yl]methyl nitrate |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3C(=O)C[C@]12CO[N+](=O)[O-] |
| InChI | InChI=1S/C21H25NO6/c1-12(23)16-5-6-17-15-4-3-13-9-14(24)7-8-20(13,2)19(15)18(25)10-21(16,17)11-28-22(26)27/h7-9,15-17,19H,3-6,10-11H2,1-2H3/t15-,16+,17-,19+,20-,21-/m0/s1 |
| InChIKey | LHYKMMVSPWXAHH-MRUFQTNVSA-N |
| XLogP | 2.87 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|