C37H44O — CID 143830150
10,13-dimethyl-3-methylidene-17-[3-[4-(2-phenylethyl)phenoxy]prop-1-en-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 143830150) has the molecular formula C37H44O and a molecular weight of 504.76 g/mol. Its IUPAC name is 10,13-dimethyl-3-methylidene-17-[3-[4-(2-phenylethyl)phenoxy]prop-1-en-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | 10,13-dimethyl-3-methylidene-17-[3-[4-(2-phenylethyl)phenoxy]prop-1-en-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 143830150 |
| Molecular Formula | C37H44O |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | 10,13-dimethyl-3-methylidene-17-[3-[4-(2-phenylethyl)phenoxy]prop-1-en-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C=C1C=CC2(C)C(=C1)CCC1C2CCC2(C)C(C(=C)COc3ccc(CCc4ccccc4)cc3)CCC12 |
| InChI | InChI=1S/C37H44O/c1-26-20-22-36(3)30(24-26)14-17-32-34-19-18-33(37(34,4)23-21-35(32)36)27(2)25-38-31-15-12-29(13-16-31)11-10-28-8-6-5-7-9-28/h5-9,12-13,15-16,20,22,24,32-35H,1-2,10-11,14,17-19,21,23,25H2,3-4H3 |
| InChIKey | ZWBWNUDMWFSSMJ-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|