C19H20N2O3 — CID 118291605
(6aS,7S,10aS)-7-methyl-10a-phenyl-5,6,6a,7,9,10-hexahydro-1H-benzo[h]quinazoline-2,4,8-trione (PubChem CID 118291605) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (6aS,7S,10aS)-7-methyl-10a-phenyl-5,6,6a,7,9,10-hexahydro-1H-benzo[h]quinazoline-2,4,8-trione.
| Compound Name | (6aS,7S,10aS)-7-methyl-10a-phenyl-5,6,6a,7,9,10-hexahydro-1H-benzo[h]quinazoline-2,4,8-trione |
|---|---|
| PubChem CID | 118291605 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (6aS,7S,10aS)-7-methyl-10a-phenyl-5,6,6a,7,9,10-hexahydro-1H-benzo[h]quinazoline-2,4,8-trione |
| SMILES | C[C@@H]1C(=O)CC[C@]2(c3ccccc3)c3[nH]c(=O)[nH]c(=O)c3CC[C@@H]12 |
| InChI | InChI=1S/C19H20N2O3/c1-11-14-8-7-13-16(20-18(24)21-17(13)23)19(14,10-9-15(11)22)12-5-3-2-4-6-12/h2-6,11,14H,7-10H2,1H3,(H2,20,21,23,24)/t11-,14-,19+/m0/s1 |
| InChIKey | OTFFFMTXDDQPRS-NXPJVHOHSA-N |
| XLogP | 1.91 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |