C21H23N5O2 — CID 153485489
(6aR,7R,10aR)-9-isocyano-4-methoxy-7,10a-dimethyl-2-(pyridin-4-ylamino)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol (PubChem CID 153485489) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is (6aR,7R,10aR)-9-isocyano-4-methoxy-7,10a-dimethyl-2-(pyridin-4-ylamino)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol.
| Compound Name | (6aR,7R,10aR)-9-isocyano-4-methoxy-7,10a-dimethyl-2-(pyridin-4-ylamino)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol |
|---|---|
| PubChem CID | 153485489 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (6aR,7R,10aR)-9-isocyano-4-methoxy-7,10a-dimethyl-2-(pyridin-4-ylamino)-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-8-ol |
| SMILES | [C-]#[N+]C1=C(O)[C@H](C)[C@H]2CCc3c(OC)nc(Nc4ccncc4)nc3[C@]2(C)C1 |
| InChI | InChI=1S/C21H23N5O2/c1-12-15-6-5-14-18(21(15,2)11-16(22-3)17(12)27)25-20(26-19(14)28-4)24-13-7-9-23-10-8-13/h7-10,12,15,27H,5-6,11H2,1-2,4H3,(H,23,24,25,26)/t12-,15-,21-/m1/s1 |
| InChIKey | BRKSODXYFNWQGS-RWCMSOCESA-N |
| XLogP | 4.17 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|