C32H32FN3O — CID 135131271
(6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(2-propan-2-ylquinolin-4-yl)-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one (PubChem CID 135131271) has the molecular formula C32H32FN3O and a molecular weight of 493.63 g/mol. Its IUPAC name is (6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(2-propan-2-ylquinolin-4-yl)-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(2-propan-2-ylquinolin-4-yl)-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 135131271 |
| Molecular Formula | C32H32FN3O |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | (6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(2-propan-2-ylquinolin-4-yl)-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
| SMILES | CC(C)c1cc(-c2nc(-c3ccccc3F)c3c(n2)[C@]2(C)CCC(=O)[C@H](C)[C@H]2CC3)c2ccccc2n1 |
| InChI | InChI=1S/C32H32FN3O/c1-18(2)27-17-23(20-9-6-8-12-26(20)34-27)31-35-29(21-10-5-7-11-25(21)33)22-13-14-24-19(3)28(37)15-16-32(24,4)30(22)36-31/h5-12,17-19,24H,13-16H2,1-4H3/t19-,24-,32-/m1/s1 |
| InChIKey | ZHRSKKICAWZMMC-MKEOQHBVSA-N |
| XLogP | 7.44 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |