C30H23FN4O2 — CID 153485465
(1R,10R,11R,13S,15S)-6-(2-fluorophenyl)-13-isocyano-4-isoquinolin-4-yl-1,11-dimethyl-14-oxa-3,5-diazatetracyclo[8.5.0.02,7.013,15]pentadeca-2,4,6-trien-12-one (PubChem CID 153485465) has the molecular formula C30H23FN4O2 and a molecular weight of 490.54 g/mol. Its IUPAC name is (1R,10R,11R,13S,15S)-6-(2-fluorophenyl)-13-isocyano-4-isoquinolin-4-yl-1,11-dimethyl-14-oxa-3,5-diazatetracyclo[8.5.0.02,7.013,15]pentadeca-2,4,6-trien-12-one.
| Compound Name | (1R,10R,11R,13S,15S)-6-(2-fluorophenyl)-13-isocyano-4-isoquinolin-4-yl-1,11-dimethyl-14-oxa-3,5-diazatetracyclo[8.5.0.02,7.013,15]pentadeca-2,4,6-trien-12-one |
|---|---|
| PubChem CID | 153485465 |
| Molecular Formula | C30H23FN4O2 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (1R,10R,11R,13S,15S)-6-(2-fluorophenyl)-13-isocyano-4-isoquinolin-4-yl-1,11-dimethyl-14-oxa-3,5-diazatetracyclo[8.5.0.02,7.013,15]pentadeca-2,4,6-trien-12-one |
| SMILES | [C-]#[N+][C@]12O[C@H]1[C@@]1(C)c3nc(-c4cncc5ccccc45)nc(-c4ccccc4F)c3CC[C@@H]1[C@@H](C)C2=O |
| InChI | InChI=1S/C30H23FN4O2/c1-16-22-13-12-20-24(19-10-6-7-11-23(19)31)34-27(21-15-33-14-17-8-4-5-9-18(17)21)35-25(20)29(22,2)28-30(32-3,37-28)26(16)36/h4-11,14-16,22,28H,12-13H2,1-2H3/t16-,22-,28+,29-,30-/m1/s1 |
| InChIKey | UMEBZOMTSZVZFZ-KVFJDKBGSA-N |
| XLogP | 5.55 |
| TPSA | 72.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|