C30H27F2N3O — CID 142378274
2-[2-(fluoromethyl)quinolin-4-yl]-4-(2-fluorophenyl)-7,7-dimethyl-5,6,6a,9,10,10a-hexahydrobenzo[h]quinazolin-8-one (PubChem CID 142378274) has the molecular formula C30H27F2N3O and a molecular weight of 483.56 g/mol. Its IUPAC name is 2-[2-(fluoromethyl)quinolin-4-yl]-4-(2-fluorophenyl)-7,7-dimethyl-5,6,6a,9,10,10a-hexahydrobenzo[h]quinazolin-8-one.
| Compound Name | 2-[2-(fluoromethyl)quinolin-4-yl]-4-(2-fluorophenyl)-7,7-dimethyl-5,6,6a,9,10,10a-hexahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 142378274 |
| Molecular Formula | C30H27F2N3O |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 2-[2-(fluoromethyl)quinolin-4-yl]-4-(2-fluorophenyl)-7,7-dimethyl-5,6,6a,9,10,10a-hexahydrobenzo[h]quinazolin-8-one |
| SMILES | CC1(C)C(=O)CCC2c3nc(-c4cc(CF)nc5ccccc45)nc(-c4ccccc4F)c3CCC21 |
| InChI | InChI=1S/C30H27F2N3O/c1-30(2)23-13-11-21-27(19(23)12-14-26(30)36)34-29(35-28(21)20-8-3-5-9-24(20)32)22-15-17(16-31)33-25-10-6-4-7-18(22)25/h3-10,15,19,23H,11-14,16H2,1-2H3 |
| InChIKey | VPQWDUBOZIRXQJ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |