C31H32FN3O4 — CID 135131786
ethyl 3-[4-[(6aR,7R,9Z,10aR)-4-(2-fluorophenyl)-9-(hydroxymethylidene)-7,10a-dimethyl-8-oxo-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-2-yl]-2-pyridinyl]propanoate (PubChem CID 135131786) has the molecular formula C31H32FN3O4 and a molecular weight of 529.61 g/mol. Its IUPAC name is ethyl 3-[4-[(6aR,7R,9Z,10aR)-4-(2-fluorophenyl)-9-(hydroxymethylidene)-7,10a-dimethyl-8-oxo-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-2-yl]-2-pyridinyl]propanoate.
| Compound Name | ethyl 3-[4-[(6aR,7R,9Z,10aR)-4-(2-fluorophenyl)-9-(hydroxymethylidene)-7,10a-dimethyl-8-oxo-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-2-yl]-2-pyridinyl]propanoate |
|---|---|
| PubChem CID | 135131786 |
| Molecular Formula | C31H32FN3O4 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | ethyl 3-[4-[(6aR,7R,9Z,10aR)-4-(2-fluorophenyl)-9-(hydroxymethylidene)-7,10a-dimethyl-8-oxo-6,6a,7,10-tetrahydro-5H-benzo[h]quinazolin-2-yl]-2-pyridinyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(-c2nc(-c3ccccc3F)c3c(n2)[C@]2(C)C/C(=C/O)C(=O)[C@H](C)[C@H]2CC3)ccn1 |
| InChI | InChI=1S/C31H32FN3O4/c1-4-39-26(37)12-9-21-15-19(13-14-33-21)30-34-27(22-7-5-6-8-25(22)32)23-10-11-24-18(2)28(38)20(17-36)16-31(24,3)29(23)35-30/h5-8,13-15,17-18,24,36H,4,9-12,16H2,1-3H3/b20-17-/t18-,24-,31-/m1/s1 |
| InChIKey | BYFJEFMNCXYIPT-BVFMNVAMSA-N |
| XLogP | 5.71 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|