C33H33FN4O — CID 135131366
(6aR,7R,10aS)-2-(2-cyclopropyl-4-pyridinyl)-4-(2-fluorophenyl)-8-oxo-7,10a-dipropyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131366) has the molecular formula C33H33FN4O and a molecular weight of 520.65 g/mol. Its IUPAC name is (6aR,7R,10aS)-2-(2-cyclopropyl-4-pyridinyl)-4-(2-fluorophenyl)-8-oxo-7,10a-dipropyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-2-(2-cyclopropyl-4-pyridinyl)-4-(2-fluorophenyl)-8-oxo-7,10a-dipropyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131366 |
| Molecular Formula | C33H33FN4O |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (6aR,7R,10aS)-2-(2-cyclopropyl-4-pyridinyl)-4-(2-fluorophenyl)-8-oxo-7,10a-dipropyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | CCC[C@H]1C(=O)C(C#N)=C[C@@]2(CCC)c3nc(-c4ccnc(C5CC5)c4)nc(-c4ccccc4F)c3CC[C@H]12 |
| InChI | InChI=1S/C33H33FN4O/c1-3-7-23-26-13-12-25-29(24-8-5-6-9-27(24)34)37-32(21-14-16-36-28(17-21)20-10-11-20)38-31(25)33(26,15-4-2)18-22(19-35)30(23)39/h5-6,8-9,14,16-18,20,23,26H,3-4,7,10-13,15H2,1-2H3/t23-,26-,33-/m1/s1 |
| InChIKey | KVTNJSQSZXHTSW-YRJDIJRFSA-N |
| XLogP | 7.27 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |