C30H39FN4O2 — CID 135132059
(6aR,7R,10aR)-4-[(2Z,4Z)-5-fluorohepta-2,4-dien-4-yl]-7,10a-dimethyl-2-(2-morpholin-4-yl-4-pyridinyl)-6,6a,7,8,9,10-hexahydro-5H-benzo[h]quinazolin-8-ol (PubChem CID 135132059) has the molecular formula C30H39FN4O2 and a molecular weight of 506.67 g/mol. Its IUPAC name is (6aR,7R,10aR)-4-[(2Z,4Z)-5-fluorohepta-2,4-dien-4-yl]-7,10a-dimethyl-2-(2-morpholin-4-yl-4-pyridinyl)-6,6a,7,8,9,10-hexahydro-5H-benzo[h]quinazolin-8-ol.
| Compound Name | (6aR,7R,10aR)-4-[(2Z,4Z)-5-fluorohepta-2,4-dien-4-yl]-7,10a-dimethyl-2-(2-morpholin-4-yl-4-pyridinyl)-6,6a,7,8,9,10-hexahydro-5H-benzo[h]quinazolin-8-ol |
|---|---|
| PubChem CID | 135132059 |
| Molecular Formula | C30H39FN4O2 |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | (6aR,7R,10aR)-4-[(2Z,4Z)-5-fluorohepta-2,4-dien-4-yl]-7,10a-dimethyl-2-(2-morpholin-4-yl-4-pyridinyl)-6,6a,7,8,9,10-hexahydro-5H-benzo[h]quinazolin-8-ol |
| SMILES | C/C=C\C(=C(\F)CC)c1nc(-c2ccnc(N3CCOCC3)c2)nc2c1CC[C@@H]1[C@@H](C)C(O)CC[C@@]21C |
| InChI | InChI=1S/C30H39FN4O2/c1-5-7-21(24(31)6-2)27-22-8-9-23-19(3)25(36)10-12-30(23,4)28(22)34-29(33-27)20-11-13-32-26(18-20)35-14-16-37-17-15-35/h5,7,11,13,18-19,23,25,36H,6,8-10,12,14-17H2,1-4H3/b7-5-,24-21-/t19-,23-,25?,30-/m1/s1 |
| InChIKey | TWELHPOSXOEFDS-SZVBJUAKSA-N |
| XLogP | 5.65 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|