C17H26O3 — CID 125113752
(3'S,4'aR,5'R,8'aS)-5',8'a-dimethyl-3'-prop-1-en-2-ylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one (PubChem CID 125113752) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (3'S,4'aR,5'R,8'aS)-5',8'a-dimethyl-3'-prop-1-en-2-ylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one.
| Compound Name | (3'S,4'aR,5'R,8'aS)-5',8'a-dimethyl-3'-prop-1-en-2-ylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one |
|---|---|
| PubChem CID | 125113752 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (3'S,4'aR,5'R,8'aS)-5',8'a-dimethyl-3'-prop-1-en-2-ylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydro-2H-naphthalene]-1'-one |
| SMILES | C=C(C)[C@@H]1CC(=O)[C@@]2(C)CCC3(OCCO3)[C@H](C)[C@H]2C1 |
| InChI | InChI=1S/C17H26O3/c1-11(2)13-9-14-12(3)17(19-7-8-20-17)6-5-16(14,4)15(18)10-13/h12-14H,1,5-10H2,2-4H3/t12-,13+,14-,16+/m1/s1 |
| InChIKey | GNDDRHOXNPUXIX-CTASWTNQSA-N |
| XLogP | 3.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|