C13H22O2 — CID 10878433
(4aS,5S,8aS)-6-methoxy-5,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one (PubChem CID 10878433) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (4aS,5S,8aS)-6-methoxy-5,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one.
| Compound Name | (4aS,5S,8aS)-6-methoxy-5,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one |
|---|---|
| PubChem CID | 10878433 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (4aS,5S,8aS)-6-methoxy-5,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one |
| SMILES | COC1CC[C@]2(C)C(=O)CCC[C@H]2[C@@H]1C |
| InChI | InChI=1S/C13H22O2/c1-9-10-5-4-6-12(14)13(10,2)8-7-11(9)15-3/h9-11H,4-8H2,1-3H3/t9-,10-,11?,13-/m0/s1 |
| InChIKey | JWQCKZZAUYFNFR-GWENJTCBSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |