C7H12O3 — CID 14977609
3-hydroxy-2,2-dimethyloxan-4-one (PubChem CID 14977609) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyloxan-4-one.
| Compound Name | 3-hydroxy-2,2-dimethyloxan-4-one |
|---|---|
| PubChem CID | 14977609 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 3-hydroxy-2,2-dimethyloxan-4-one |
| SMILES | CC1(C)OCCC(=O)C1O |
| InChI | InChI=1S/C7H12O3/c1-7(2)6(9)5(8)3-4-10-7/h6,9H,3-4H2,1-2H3 |
| InChIKey | VWZNUNIGZFUPQD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |