C11H18O2 — CID 10702587
2-methyl-2-[(1R,2R)-2-methylcyclohex-3-en-1-yl]-1,3-dioxolane (PubChem CID 10702587) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-methyl-2-[(1R,2R)-2-methylcyclohex-3-en-1-yl]-1,3-dioxolane.
| Compound Name | 2-methyl-2-[(1R,2R)-2-methylcyclohex-3-en-1-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 10702587 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-methyl-2-[(1R,2R)-2-methylcyclohex-3-en-1-yl]-1,3-dioxolane |
| SMILES | C[C@@H]1C=CCC[C@H]1C1(C)OCCO1 |
| InChI | InChI=1S/C11H18O2/c1-9-5-3-4-6-10(9)11(2)12-7-8-13-11/h3,5,9-10H,4,6-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | MOHNJQXWKBQHRU-NXEZZACHSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|