About 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium
7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium (PubChem CID 174857221) has the molecular formula C6H6O2Ti
and a molecular weight of 157.98 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium.
Molecular Properties
| Compound Name | 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium |
| PubChem CID | 174857221 |
| Molecular Formula | C6H6O2Ti |
| Molecular Weight | 157.98 g/mol |
| Exact Mass | 157.98 |
| IUPAC Name | 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium |
| SMILES | OC12C=CC=CC1O2.[Ti] |
| InChI | InChI=1S/C6H6O2.Ti/c7-6-4-2-1-3-5(6)8-6;/h1-5,7H; |
| InChIKey | AMNAXHCIQODSIR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.98 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium?
The IUPAC name of 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium (CID 174857221) is 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium.
What is the SMILES notation for 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium?
The canonical SMILES for 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium is OC12C=CC=CC1O2.[Ti].
What is the InChIKey of 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium?
The InChIKey is AMNAXHCIQODSIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.Ti/c7-6-4-2-1-3-5(6)8-6;/h1-5,7H;.
What are the key properties of 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium?
7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium has a molecular weight of 157.98 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[4.1.0]hepta-2,4-dien-1-ol;titanium is sourced from PubChem (CID 174857221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).