C10H12O2 — CID 86735268
1-(3-methoxyprop-2-enyl)-7-oxabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 86735268) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 1-(3-methoxyprop-2-enyl)-7-oxabicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 1-(3-methoxyprop-2-enyl)-7-oxabicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 86735268 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1-(3-methoxyprop-2-enyl)-7-oxabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | COC=CCC12C=CC=CC1O2 |
| InChI | InChI=1S/C10H12O2/c1-11-8-4-7-10-6-3-2-5-9(10)12-10/h2-6,8-9H,7H2,1H3 |
| InChIKey | GGLUSLZBEBRGNJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|