C10H18N2O — CID 143109244
1-(3-methoxypropyl)cyclohexa-3,5-diene-1,2-diamine (PubChem CID 143109244) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-(3-methoxypropyl)cyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 1-(3-methoxypropyl)cyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 143109244 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 1-(3-methoxypropyl)cyclohexa-3,5-diene-1,2-diamine |
| SMILES | COCCCC1(N)C=CC=CC1N |
| InChI | InChI=1S/C10H18N2O/c1-13-8-4-7-10(12)6-3-2-5-9(10)11/h2-3,5-6,9H,4,7-8,11-12H2,1H3 |
| InChIKey | NMFXTHDBVMCRNW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|