C12H25NO2 — CID 11550281
(1S)-1-[(1R,2R)-2-amino-2-(3-methoxypropyl)cyclohexyl]ethanol (PubChem CID 11550281) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is (1S)-1-[(1R,2R)-2-amino-2-(3-methoxypropyl)cyclohexyl]ethanol.
| Compound Name | (1S)-1-[(1R,2R)-2-amino-2-(3-methoxypropyl)cyclohexyl]ethanol |
|---|---|
| PubChem CID | 11550281 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | (1S)-1-[(1R,2R)-2-amino-2-(3-methoxypropyl)cyclohexyl]ethanol |
| SMILES | COCCC[C@]1(N)CCCC[C@H]1[C@H](C)O |
| InChI | InChI=1S/C12H25NO2/c1-10(14)11-6-3-4-7-12(11,13)8-5-9-15-2/h10-11,14H,3-9,13H2,1-2H3/t10-,11-,12+/m0/s1 |
| InChIKey | CSACIQMSSUCQSS-SDDRHHMPSA-N |
| XLogP | 1.68 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|