C9H17N3O — CID 154193878
2-(3-methoxypropyl)-1H-pyridine-2,5-diamine (PubChem CID 154193878) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-1H-pyridine-2,5-diamine.
| Compound Name | 2-(3-methoxypropyl)-1H-pyridine-2,5-diamine |
|---|---|
| PubChem CID | 154193878 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 2-(3-methoxypropyl)-1H-pyridine-2,5-diamine |
| SMILES | COCCCC1(N)C=CC(N)=CN1 |
| InChI | InChI=1S/C9H17N3O/c1-13-6-2-4-9(11)5-3-8(10)7-12-9/h3,5,7,12H,2,4,6,10-11H2,1H3 |
| InChIKey | OIUFWPBAXDDPHK-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|