C10H19N3O — CID 154455033
2-(1-methoxybutan-2-yl)-1H-pyridine-2,3-diamine (PubChem CID 154455033) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(1-methoxybutan-2-yl)-1H-pyridine-2,3-diamine.
| Compound Name | 2-(1-methoxybutan-2-yl)-1H-pyridine-2,3-diamine |
|---|---|
| PubChem CID | 154455033 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-(1-methoxybutan-2-yl)-1H-pyridine-2,3-diamine |
| SMILES | CCC(COC)C1(N)NC=CC=C1N |
| InChI | InChI=1S/C10H19N3O/c1-3-8(7-14-2)10(12)9(11)5-4-6-13-10/h4-6,8,13H,3,7,11-12H2,1-2H3 |
| InChIKey | DYAIIJWUSFXDRM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |