C10H19N3O — CID 152574327
2-(3-methoxypropyl)-2-N-methyl-1H-pyridine-2,5-diamine (PubChem CID 152574327) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-2-N-methyl-1H-pyridine-2,5-diamine.
| Compound Name | 2-(3-methoxypropyl)-2-N-methyl-1H-pyridine-2,5-diamine |
|---|---|
| PubChem CID | 152574327 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-(3-methoxypropyl)-2-N-methyl-1H-pyridine-2,5-diamine |
| SMILES | CNC1(CCCOC)C=CC(N)=CN1 |
| InChI | InChI=1S/C10H19N3O/c1-12-10(5-3-7-14-2)6-4-9(11)8-13-10/h4,6,8,12-13H,3,5,7,11H2,1-2H3 |
| InChIKey | YSDOEFHZEFFMLZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|